EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19NO4 |
| Net Charge | 0 |
| Average Mass | 301.342 |
| Monoisotopic Mass | 301.13141 |
| SMILES | [H][C@@]12c3cc(OC)c(O)cc3C(=O)O[C@]1([H])CC=C1CCN(C)[C@]12[H] |
| InChI | InChI=1S/C17H19NO4/c1-18-6-5-9-3-4-13-15(16(9)18)10-8-14(21-2)12(19)7-11(10)17(20)22-13/h3,7-8,13,15-16,19H,4-6H2,1-2H3/t13-,15-,16-/m1/s1 |
| InChIKey | VLDOBKJPRUQEEC-FVQBIDKESA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-O-Demethylhomolycorine (CHEBI:31154) is a alkaloid (CHEBI:22315) |
| Synonym | Source |
|---|---|
| 9-O-Demethylhomolycorine | KEGG COMPOUND |