EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3115 - Bipindoside
| Formula | C29H44O10 |
| Net Charge | 0 |
| Average Mass | 552.661 |
| Monoisotopic Mass | 552.29345 |
| SMILES | [H][C@@]12CC[C@]3(O)C[C@@H](O[C@@H]4O[C@@H](C)[C@@H](O)[C@@H](O)[C@H]4O)CC[C@]3(C)[C@@]1([H])[C@H](O)C[C@@]1(C)[C@]2(O)CC[C@]1([H])C1=CC(=O)OC1 |
| InChI | InChI=1S/C29H44O10/c1-14-22(32)23(33)24(34)25(38-14)39-16-4-7-26(2)21-18(5-8-28(26,35)11-16)29(36)9-6-17(15-10-20(31)37-13-15)27(29,3)12-19(21)30/h10,14,16-19,21-25,30,32-36H,4-9,11-13H2,1-3H3/t14-,16-,17+,18+,19+,21+,22+,23+,24+,25-,26+,27+,28-,29-/m0/s1 |
| InChIKey | WRORFDCUNLGVJF-NKSXRMIXSA-N |
| Roles Classification |
|---|
| Application: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bipindoside (CHEBI:3115) is a cardenolide glycoside (CHEBI:38092) |
| Synonym | Source |
|---|---|
| Bipindoside | KEGG COMPOUND |