EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H17NO5 |
| Net Charge | 0 |
| Average Mass | 363.369 |
| Monoisotopic Mass | 363.11067 |
| SMILES | COc1ccc2c(c1OC)c(=O)n(C)c1c3cc4c(cc3ccc21)OCO4 |
| InChI | InChI=1S/C21H17NO5/c1-22-19-13(5-4-11-8-16-17(9-14(11)19)27-10-26-16)12-6-7-15(24-2)20(25-3)18(12)21(22)23/h4-9H,10H2,1-3H3 |
| InChIKey | IHTXRYTWDARUKX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-Oxochelerythrine (CHEBI:31141) is a benzophenanthridine alkaloid (CHEBI:38517) |
| Synonyms | Source |
|---|---|
| 6-Oxochelerythrine | KEGG COMPOUND |
| Oxychelerythrine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C12225 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:28342-33-8 | KEGG COMPOUND |