EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19NO5 |
| Net Charge | 0 |
| Average Mass | 329.352 |
| Monoisotopic Mass | 329.12632 |
| SMILES | [H][C@]12C[C@@H](OC(C)=O)C=C[C@]13c1cc4c(cc1C[N@@]2C[C@@H]3O)OCO4 |
| InChI | InChI=1S/C18H19NO5/c1-10(20)24-12-2-3-18-13-6-15-14(22-9-23-15)4-11(13)7-19(8-17(18)21)16(18)5-12/h2-4,6,12,16-17,21H,5,7-9H2,1H3/t12-,16-,17-,18-/m0/s1 |
| InChIKey | NWAYYOQRSAEORM-JUKXBJQTSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-O-Acetylhamayne (CHEBI:31120) is a alkaloid (CHEBI:22315) |
| Synonym | Source |
|---|---|
| 3-O-Acetylhamayne | KEGG COMPOUND |