EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O3 |
| Net Charge | 0 |
| Average Mass | 206.241 |
| Monoisotopic Mass | 206.09429 |
| SMILES | CC(C)=CCc1cc(C(=O)O)ccc1O |
| InChI | InChI=1S/C12H14O3/c1-8(2)3-4-9-7-10(12(14)15)5-6-11(9)13/h3,5-7,13H,4H2,1-2H3,(H,14,15) |
| InChIKey | LBSJJNAMGVDGCU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rubia yunnanensis (IPNI:765385-1) | root (BTO:0001188) | PubMed (21973054) | Methanolic extract of air dried powdered roots. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-dimethylallyl-4-hydroxybenzoic acid (CHEBI:31111) has role plant metabolite (CHEBI:76924) |
| 3-dimethylallyl-4-hydroxybenzoic acid (CHEBI:31111) is a monohydroxybenzoic acid (CHEBI:25389) |
| 3-dimethylallyl-4-hydroxybenzoic acid (CHEBI:31111) is conjugate acid of 3-dimethylallyl-4-hydroxybenzoate (CHEBI:74155) |
| Incoming Relation(s) |
| 3-dimethylallyl-4-hydroxybenzoate (CHEBI:74155) is conjugate base of 3-dimethylallyl-4-hydroxybenzoic acid (CHEBI:31111) |
| IUPAC Name |
|---|
| 4-hydroxy-3-(3-methylbut-2-en-1-yl)benzoic acid |
| Synonym | Source |
|---|---|
| 4-hydroxy-3-prenylbenzoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C12458 | KEGG COMPOUND |
| WO2009098287 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2644226 | Reaxys |
| Citations |
|---|