EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O6 |
| Net Charge | 0 |
| Average Mass | 212.157 |
| Monoisotopic Mass | 212.03209 |
| SMILES | [H]C(=CC(=O)O)C(=O)C([H])=CC([H])=C(O)C(=O)O |
| InChI | InChI=1S/C9H8O6/c10-6(4-5-8(12)13)2-1-3-7(11)9(14)15/h1-5,11H,(H,12,13)(H,14,15) |
| InChIKey | WCJYZUFKKTYNLB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-6-oxonona-2,4,7-trienedioic acid (CHEBI:31082) is a nonatrienedicarboxylic acid (CHEBI:49264) |
| 2-hydroxy-6-oxonona-2,4,7-trienedioic acid (CHEBI:31082) is conjugate acid of 2-hydroxy-6-oxonona-2,4,7-trienedioate (CHEBI:58637) |
| Incoming Relation(s) |
| (2E,4Z,7E)-2-hydroxy-6-oxonona-2,4,7-trienedioic acid (CHEBI:61467) is a 2-hydroxy-6-oxonona-2,4,7-trienedioic acid (CHEBI:31082) |
| (2Z,4E,7E)-2-hydroxy-6-oxonona-2,4,7-trienedioic acid (CHEBI:66939) is a 2-hydroxy-6-oxonona-2,4,7-trienedioic acid (CHEBI:31082) |
| 2-hydroxy-6-oxonona-2,4,7-trienedioate (CHEBI:58637) is conjugate base of 2-hydroxy-6-oxonona-2,4,7-trienedioic acid (CHEBI:31082) |
| IUPAC Name |
|---|
| 2-hydroxy-6-oxonona-2,4,7-trienedioic acid |
| Synonym | Source |
|---|---|
| 2-Hydroxy-6-ketononatrienedioate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C12624 | KEGG COMPOUND |