EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H3Cl3O4 |
| Net Charge | 0 |
| Average Mass | 245.445 |
| Monoisotopic Mass | 243.90969 |
| SMILES | O=C(O)/C(Cl)=C(Cl)\C=C(\Cl)C(=O)O |
| InChI | InChI=1S/C6H3Cl3O4/c7-2(4(9)6(12)13)1-3(8)5(10)11/h1H,(H,10,11)(H,12,13)/b3-1+,4-2- |
| InChIKey | AHDWVTPNJCBFTN-TZFCGSKZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3,5-trichloro-cis,cis-muconic acid (CHEBI:31069) has functional parent cis,cis-muconic acid (CHEBI:16508) |
| 2,3,5-trichloro-cis,cis-muconic acid (CHEBI:31069) is a trichloromuconic acid (CHEBI:38448) |
| 2,3,5-trichloro-cis,cis-muconic acid (CHEBI:31069) is conjugate acid of 2,3,5-trichloro-cis,cis-muconate(1−) (CHEBI:38427) |
| Incoming Relation(s) |
| 2,3,5-trichloro-cis,cis-muconate(1−) (CHEBI:38427) is conjugate base of 2,3,5-trichloro-cis,cis-muconic acid (CHEBI:31069) |
| IUPAC Name |
|---|
| (2Z,4E)-2,3,5-trichlorohexa-2,4-dienedioic acid |
| Manual Xrefs | Databases |
|---|---|
| C12833 | KEGG COMPOUND |