EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O6 |
| Net Charge | 0 |
| Average Mass | 286.239 |
| Monoisotopic Mass | 286.04774 |
| SMILES | O=c1c(-c2ccc(O)cc2O)coc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C15H10O6/c16-7-1-2-9(11(18)3-7)10-6-21-13-5-8(17)4-12(19)14(13)15(10)20/h1-6,16-19H |
| InChIKey | GSSOWCUOWLMMRJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Crotalaria lachnophora (IPNI:488342-1) | whole plant (BTO:0001461) | PubMed (21265557) | Chloroform soluble fraction of CH2Cl2/MeOH (1:1) crude extract of dried and powdered whole plant |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2'-hydroxygenistein (CHEBI:70031) has functional parent genistein (CHEBI:28088) |
| 2'-hydroxygenistein (CHEBI:70031) has role plant metabolite (CHEBI:76924) |
| 2'-hydroxygenistein (CHEBI:70031) is a hydroxyisoflavone (CHEBI:38755) |
| 2'-hydroxygenistein (CHEBI:70031) is conjugate acid of 2'-hydroxygenistein(1−) (CHEBI:140306) |
| Incoming Relation(s) |
| 2'-hydroxygenistein(1−) (CHEBI:140306) is conjugate base of 2'-hydroxygenistein (CHEBI:70031) |
| IUPAC Name |
|---|
| 3-(2,4-dihydroxyphenyl)-5,7-dihydroxy-4-1H-benzopyran-4-one |
| Synonyms | Source |
|---|---|
| 2',4',5,7-Tetrahydroxyisoflavone | KEGG COMPOUND |
| 3-(2,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00009453 | KNApSAcK |
| C12134 | KEGG COMPOUND |
| HMDB0034014 | HMDB |
| LMPK12050327 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:299569 | Reaxys |
| CAS:1156-78-1 | ChemIDplus |
| CAS:1156-78-1 | KEGG COMPOUND |
| Citations |
|---|