EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O6 |
| Net Charge | 0 |
| Average Mass | 300.266 |
| Monoisotopic Mass | 300.06339 |
| SMILES | COc1ccc(-c2coc3cc(O)cc(O)c3c2=O)c(O)c1 |
| InChI | InChI=1S/C16H12O6/c1-21-9-2-3-10(12(18)6-9)11-7-22-14-5-8(17)4-13(19)15(14)16(11)20/h2-7,17-19H,1H3 |
| InChIKey | OZEVXMDBOINMTC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pycnanthus angolensis (ncbitaxon:224864) | - | PubMed (21495101) |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2'-hydroxybiochanin A (CHEBI:31064) has role apoptosis inducer (CHEBI:68495) |
| 2'-hydroxybiochanin A (CHEBI:31064) has role plant metabolite (CHEBI:76924) |
| 2'-hydroxybiochanin A (CHEBI:31064) is a 2'-hydroxyisoflavones (CHEBI:28206) |
| 2'-hydroxybiochanin A (CHEBI:31064) is a 4'-methoxyisoflavones (CHEBI:133959) |
| 2'-hydroxybiochanin A (CHEBI:31064) is a 7-hydroxyisoflavones (CHEBI:55465) |
| 2'-hydroxybiochanin A (CHEBI:31064) is a methoxyisoflavone (CHEBI:38756) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-3-(2-hydroxy-4-methoxyphenyl)-4H-1-benzopyran-4-one |
| Synonyms | Source |
|---|---|
| 2'-Hydroxybiochanin A | KEGG COMPOUND |
| 5,7,2'-Trihydroxy-4'-methoxyisoflavone | KNApSAcK |
| Dehydroferreirin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00009457 | KNApSAcK |
| C12135 | KEGG COMPOUND |
| LMPK12050328 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1325822 | Reaxys |
| CAS:32884-35-8 | KNApSAcK |
| Citations |
|---|