EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12O3 |
| Net Charge | 0 |
| Average Mass | 168.192 |
| Monoisotopic Mass | 168.07864 |
| SMILES | COc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C9H12O3/c1-10-7-4-8(11-2)6-9(5-7)12-3/h4-6H,1-3H3 |
| InChIKey | LKUDPHPHKOZXCD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| Application: | biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3,5-trimethoxybenzene (CHEBI:31038) has role biomarker (CHEBI:59163) |
| 1,3,5-trimethoxybenzene (CHEBI:31038) has role human xenobiotic metabolite (CHEBI:76967) |
| 1,3,5-trimethoxybenzene (CHEBI:31038) is a methoxybenzenes (CHEBI:51683) |
| IUPAC Name |
|---|
| 1,3,5-trimethoxybenzene |
| Synonyms | Source |
|---|---|
| sym-trimethoxybenzene | ChemIDplus |
| phloroglucinol trimethyl ether | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 1,3,5-trimethoxybenzene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| D01792 | KEGG DRUG |
| HMDB0059963 | HMDB |
| LSM-24973 | LINCS |
| Citations |
|---|