EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21NO4 |
| Net Charge | 0 |
| Average Mass | 327.380 |
| Monoisotopic Mass | 327.14706 |
| SMILES | COc1cc2c(cc1O)C1Cc3ccc(OC)c(O)c3CN1CC2 |
| InChI | InChI=1S/C19H21NO4/c1-23-17-4-3-11-7-15-13-9-16(21)18(24-2)8-12(13)5-6-20(15)10-14(11)19(17)22/h3-4,8-9,15,21-22H,5-7,10H2,1-2H3 |
| InChIKey | KNWVMRVOBAFFMH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R,S)-Scoulerine (CHEBI:31033) is a alkaloid (CHEBI:22315) |
| Synonyms | Source |
|---|---|
| (R,S)-Scoulerine | KEGG COMPOUND |
| Scoulerine | KEGG COMPOUND |