EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H31NO10 |
| Net Charge | 0 |
| Average Mass | 529.542 |
| Monoisotopic Mass | 529.19480 |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)([C@H](C)O)C[C@@H]3O[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 |
| InChI | InChI=1S/C27H31NO10/c1-10-22(30)14(28)7-17(37-10)38-16-9-27(35,11(2)29)8-13-19(16)26(34)21-20(24(13)32)23(31)12-5-4-6-15(36-3)18(12)25(21)33/h4-6,10-11,14,16-17,22,29-30,32,34-35H,7-9,28H2,1-3H3/t10-,11-,14-,16-,17-,22+,27-/m0/s1 |
| InChIKey | HJEZFVLKJYFNQW-PRFXOSGESA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (13S)-13-dihydrodaunorubicin (CHEBI:31031) is a 13-dihydrodaunorubicin (CHEBI:31059) |
| IUPAC Name |
|---|
| (1S,3S)-3,5,12-trihydroxy-3-[(1S)-1-hydroxyethyl]-10-methoxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracen-1-yl 3-amino-2,3,6-trideoxy-α-L-lyxo-hexopyranoside |
| Manual Xrefs | Databases |
|---|---|
| 4719 | DrugCentral |
| C12433 | KEGG COMPOUND |
| LMPK13050005 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6773803 | Reaxys |