EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O5 |
| Net Charge | 0 |
| Average Mass | 274.272 |
| Monoisotopic Mass | 274.08412 |
| SMILES | Oc1ccc([C@H]2Oc3cc(O)cc(O)c3C[C@H]2O)cc1 |
| InChI | InChI=1S/C15H14O5/c16-9-3-1-8(2-4-9)15-13(19)7-11-12(18)5-10(17)6-14(11)20-15/h1-6,13,15-19H,7H2/t13-,15-/m1/s1 |
| InChIKey | RSYUFYQTACJFML-UKRRQHHQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cassia sieberiana (IPNI:485224-1) | root (BTO:0001188) | PubMed (21070009) | Previous component: root bark; 95% ethanolic extract of dried pieces of root bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-epiafzelechin (CHEBI:31028) has role plant metabolite (CHEBI:76924) |
| (−)-epiafzelechin (CHEBI:31028) is a catechin (CHEBI:23053) |
| Incoming Relation(s) |
| epiafzelechin 3-gallate (CHEBI:136552) has functional parent (−)-epiafzelechin (CHEBI:31028) |
| IUPAC Name |
|---|
| (2R,3R)-2-(4-hydroxyphenyl)chromane-3,5,7-triol |
| Synonyms | Source |
|---|---|
| (2R,3R)-epiafzelechin | ChEBI |
| epi-Afzelechin | KEGG COMPOUND |
| (-)-Epiafzelechin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00008805 | KNApSAcK |
| C12128 | KEGG COMPOUND |
| CPD-10413 | MetaCyc |
| HMDB0030822 | HMDB |
| LSM-24974 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4236089 | Reaxys |
| Citations |
|---|