EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H23NO5 |
| Net Charge | 0 |
| Average Mass | 405.450 |
| Monoisotopic Mass | 405.15762 |
| SMILES | COc1ccc2c(c1OC)C(CC(C)=O)N(C)c1c-2ccc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C24H23NO5/c1-13(26)9-18-22-15(7-8-19(27-3)24(22)28-4)16-6-5-14-10-20-21(30-12-29-20)11-17(14)23(16)25(18)2/h5-8,10-11,18H,9,12H2,1-4H3 |
| InChIKey | VGTQLFWIJIABSU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+/-)-6-Acetonyldihydrochelerythrine (CHEBI:31021) is a benzophenanthridine alkaloid (CHEBI:38517) |
| Synonyms | Source |
|---|---|
| 6-Acetonyl-5,6-dihydrochelerythrine | KEGG COMPOUND |
| (+/-)-6-Acetonyldihydrochelerythrine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C12200 | KEGG COMPOUND |