EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H51O2 |
| Net Charge | -1 |
| Average Mass | 395.692 |
| Monoisotopic Mass | 395.38945 |
| SMILES | CCCCCCCCCCCCCCCCCCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C26H52O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26(27)28/h2-25H2,1H3,(H,27,28)/p-1 |
| InChIKey | XMHIUKTWLZUKEX-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cerotate (CHEBI:31013) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| cerotate (CHEBI:31013) has role human metabolite (CHEBI:77746) |
| cerotate (CHEBI:31013) is a fatty acid anion 26:0 (CHEBI:78129) |
| cerotate (CHEBI:31013) is a very long-chain fatty acid anion (CHEBI:58950) |
| cerotate (CHEBI:31013) is a ω-methyl fatty acid anion (CHEBI:76619) |
| cerotate (CHEBI:31013) is conjugate base of hexacosanoic acid (CHEBI:31009) |
| Incoming Relation(s) |
| 2-hydroxyhexacosanoate (CHEBI:76728) has functional parent cerotate (CHEBI:31013) |
| hexacosanoic acid (CHEBI:31009) is conjugate acid of cerotate (CHEBI:31013) |
| IUPAC Name |
|---|
| hexacosanoate |
| Synonyms | Source |
|---|---|
| cerate | ChEBI |
| ceratinate | ChEBI |
| cerinate | ChEBI |
| cerotate | IUBMB |
| cerylate | ChEBI |
| CH3‒[CH2]24‒COO− | IUPAC |
| UniProt Name | Source |
|---|---|
| hexacosanoate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:374171 | Gmelin |
| Citations |
|---|