EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31007 - octafluorocyclobutane
| Formula | C4F8 |
| Net Charge | 0 |
| Average Mass | 200.028 |
| Monoisotopic Mass | 199.98723 |
| SMILES | FC1(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C4F8/c5-1(6)2(7,8)4(11,12)3(1,9)10 |
| InChIKey | BCCOBQSFUDVTJQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | food packaging gas A food additive that is a (generally inert) gas which is used to envelop foodstuffs during packing and so protect them from unwanted chemical reactions such as food spoilage or oxidation during subsequent transport and storage. The term includes propellant gases, used to expel foods from a container. food propellant A propellant that is used to expel foods from an aerosol container. |
| Applications: | food packaging gas A food additive that is a (generally inert) gas which is used to envelop foodstuffs during packing and so protect them from unwanted chemical reactions such as food spoilage or oxidation during subsequent transport and storage. The term includes propellant gases, used to expel foods from a container. food propellant A propellant that is used to expel foods from an aerosol container. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| octafluorocyclobutane (CHEBI:31007) has parent hydride cyclobutane (CHEBI:30377) |
| octafluorocyclobutane (CHEBI:31007) has role food packaging gas (CHEBI:77974) |
| octafluorocyclobutane (CHEBI:31007) has role food propellant (CHEBI:78017) |
| octafluorocyclobutane (CHEBI:31007) is a cyclobutanes (CHEBI:156473) |
| octafluorocyclobutane (CHEBI:31007) is a fluorocarbon (CHEBI:38824) |
| IUPAC Name |
|---|
| octafluorocyclobutane |
| Synonyms | Source |
|---|---|
| Freon C-318 | ChemIDplus |
| Freon C 318 | NIST Chemistry WebBook |
| Freon 318 | NIST Chemistry WebBook |
| perfluorocyclobutane | NIST Chemistry WebBook |
| 1,1,2,2,3,3,4,4-octafluorocyclobutane | NIST Chemistry WebBook |
| E946 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0031292 | HMDB |
| Octafluorocyclobutane | Wikipedia |
| Citations |
|---|