EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O5 |
| Net Charge | 0 |
| Average Mass | 162.141 |
| Monoisotopic Mass | 162.05282 |
| SMILES | O[C@@H]1[C@@H](O)[C@@H]2OC[C@@H](O2)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a2122h-1b_1-5_1-6]/1/ |
| InChI | InChI=1S/C6H10O5/c7-3-2-1-10-6(11-2)5(9)4(3)8/h2-9H,1H2/t2-,3-,4+,5-,6-/m1/s1 |
| InChIKey | TWNIBLMWSKIRAT-VFUOTHLCSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| - | MetaboLights (MTBLS22) | From MetaboLights | |
| - | MetaboLights (MTBLS7) | From MetaboLights | |
| - | MetaboLights (MTBLS12) | From MetaboLights | |
| - | MetaboLights (MTBLS11) | From MetaboLights | |
| - | MetaboLights (MTBLS13) | From MetaboLights | |
| - | MetaboLights (MTBLS42) | From MetaboLights | |
| - | MetaboLights (MTBLS41) | From MetaboLights | |
| - | MetaboLights (MTBLS45) | From MetaboLights | |
| - | MetaboLights (MTBLS40) | From MetaboLights | |
| Homo sapiens (ncbitaxon:9606) | |||
| - | MetaboLights (MTBLS290) | From MetaboLights | |
| urine (BTO:0001419) | PubMed (21389975) | ||
| - | PubMed (19165390) | ||
| urine (BTO:0001419) | MetaboLights (MTBLS290) | From MetaboLights | |
| faeces (UBERON:0001988) | PubMed (22411374) | ||
| feces (UBERON:0001988) | MetaboLights (MTBLS290) | From MetaboLights | |
| Lotus japonicus (ncbitaxon:34305) | |||
| - | MetaboLights (MTBLS44) | From MetaboLights | |
| - | MetaboLights (MTBLS15) | From MetaboLights | |
| - | MetaboLights (MTBLS43) | From MetaboLights | |
| - | MetaboLights (MTBLS54) | From MetaboLights | |
| - | MetaboLights (MTBLS16) | From MetaboLights | |
| - | MetaboLights (MTBLS14) | From MetaboLights | |
| Populus deltoides (ncbitaxon:3696) | - | MetaboLights (MTBLS332) | From MetaboLights |
| Pseudomonas putida (ncbitaxon:303) | - | MetaboLights (MTBLS320) | From MetaboLights |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | MetaboLights (MTBLS8) | From MetaboLights |
| Sus scrofa domesticus (ncbitaxon:9825) | - | MetaboLights (MTBLS123) | From MetaboLights |
| Roles Classification |
|---|
| Biological Roles: | Arabidopsis thaliana metabolite Any plant metabolite that is produced by Arabidopsis thaliana. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| levoglucosan (CHEBI:30997) has role Arabidopsis thaliana metabolite (CHEBI:140602) |
| levoglucosan (CHEBI:30997) has role biomarker (CHEBI:59163) |
| levoglucosan (CHEBI:30997) has role human metabolite (CHEBI:77746) |
| levoglucosan (CHEBI:30997) is a anhydrohexose (CHEBI:22557) |
| Incoming Relation(s) |
| 3-dehydrolevoglucosan (CHEBI:144894) has functional parent levoglucosan (CHEBI:30997) |
| IUPAC Names |
|---|
| 1,6-anhydro-β-D-glucopyranose |
| (1R,2S,3S,4R,5R)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol |
| Synonyms | Source |
|---|---|
| 1,6-Anhydro-beta-D-glucose | ChemIDplus |
| 1,6-Anhydro-beta-glucopyranose | ChemIDplus |
| 1,6-anhydroglucose | HMDB |
| 1,6-anhydro-β-D-glucose | HMDB |
| 6,8-dioxabicyclo[3.2.1]octane, β-D-glucopyranose deriv | HMDB |
| Glucosan | HMDB |
| UniProt Name | Source |
|---|---|
| levoglucosan | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 4PW | PDBeChem |
| C00007411 | KNApSAcK |
| C22350 | KEGG COMPOUND |
| CPD-12923 | MetaCyc |
| FDB005117 | FooDB |
| HMDB0000640 | HMDB |
| Levoglucosan | Wikipedia |
| Citations |
|---|