EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3096 - bikaverin
| Formula | C20H14O8 |
| Net Charge | 0 |
| Average Mass | 382.324 |
| Monoisotopic Mass | 382.06887 |
| SMILES | COC1=CC(=O)c2c(c(O)c3oc4cc(OC)cc(C)c4c(=O)c3c2O)C1=O |
| InChI | InChI=1S/C20H14O8/c1-7-4-8(26-2)5-10-12(7)17(23)15-18(24)13-9(21)6-11(27-3)16(22)14(13)19(25)20(15)28-10/h4-6,24-25H,1-3H3 |
| InChIKey | ZOQMSOSJEWBMHP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium sp. (ncbitaxon:29916) | - | PubMed (24183988) | Strain: HKF15 |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bikaverin (CHEBI:3096) has role antibacterial agent (CHEBI:33282) |
| bikaverin (CHEBI:3096) has role antifungal agent (CHEBI:35718) |
| bikaverin (CHEBI:3096) has role fungal metabolite (CHEBI:76946) |
| bikaverin (CHEBI:3096) is a aromatic ether (CHEBI:35618) |
| bikaverin (CHEBI:3096) is a cyclic ether (CHEBI:37407) |
| bikaverin (CHEBI:3096) is a cyclic ketone (CHEBI:3992) |
| bikaverin (CHEBI:3096) is a organic heterotetracyclic compound (CHEBI:38163) |
| bikaverin (CHEBI:3096) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 6,11-dihydroxy-3,8-dimethoxy-1-methyl-10H-benzo[b]xanthene-7,10,12-trione |
| Synonym | Source |
|---|---|
| Lycopersin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:358013 | Reaxys |
| CAS:33390-21-5 | KEGG COMPOUND |
| CAS:33390-21-5 | ChemIDplus |
| Citations |
|---|