EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H14O8 |
| Net Charge | 0 |
| Average Mass | 382.324 |
| Monoisotopic Mass | 382.06887 |
| SMILES | COC1=CC(=O)c2c(c(O)c3oc4cc(OC)cc(C)c4c(=O)c3c2O)C1=O |
| InChI | InChI=1S/C20H14O8/c1-7-4-8(26-2)5-10-12(7)17(23)15-18(24)13-9(21)6-11(27-3)16(22)14(13)19(25)20(15)28-10/h4-6,24-25H,1-3H3 |
| InChIKey | ZOQMSOSJEWBMHP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium sp. (ncbitaxon:29916) | - | PubMed (24183988) | Strain: HKF15 |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bikaverin (CHEBI:3096) has role antibacterial agent (CHEBI:33282) |
| bikaverin (CHEBI:3096) has role antifungal agent (CHEBI:35718) |
| bikaverin (CHEBI:3096) has role fungal metabolite (CHEBI:76946) |
| bikaverin (CHEBI:3096) is a aromatic ether (CHEBI:35618) |
| bikaverin (CHEBI:3096) is a cyclic ether (CHEBI:37407) |
| bikaverin (CHEBI:3096) is a cyclic ketone (CHEBI:3992) |
| bikaverin (CHEBI:3096) is a organic heterotetracyclic compound (CHEBI:38163) |
| bikaverin (CHEBI:3096) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 6,11-dihydroxy-3,8-dimethoxy-1-methyl-10H-benzo[b]xanthene-7,10,12-trione |
| Synonym | Source |
|---|---|
| Lycopersin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:358013 | Reaxys |
| CAS:33390-21-5 | KEGG COMPOUND |
| CAS:33390-21-5 | ChemIDplus |
| Citations |
|---|