EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:30929 - 2,3-dihydroxybutanedioate
| Formula | C4H4O6 |
| Net Charge | -2 |
| Average Mass | 148.070 |
| Monoisotopic Mass | 148.00189 |
| SMILES | O=C([O-])C(O)C(O)C(=O)[O-] |
| InChI | InChI=1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/p-2 |
| InChIKey | FEWJPZIEWOKRBE-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-dihydroxybutanedioate (CHEBI:30929) has role human xenobiotic metabolite (CHEBI:76967) |
| 2,3-dihydroxybutanedioate (CHEBI:30929) has role plant metabolite (CHEBI:76924) |
| 2,3-dihydroxybutanedioate (CHEBI:30929) is a C4-dicarboxylate (CHEBI:61336) |
| 2,3-dihydroxybutanedioate (CHEBI:30929) is a tartrate (CHEBI:132950) |
| 2,3-dihydroxybutanedioate (CHEBI:30929) is conjugate base of 3-carboxy-2,3-dihydroxypropanoate (CHEBI:48929) |
| Incoming Relation(s) |
| meso-tartrate(2−) (CHEBI:30928) is a 2,3-dihydroxybutanedioate (CHEBI:30929) |
| D-tartrate(2−) (CHEBI:30927) is a 2,3-dihydroxybutanedioate (CHEBI:30929) |
| L-tartrate(2−) (CHEBI:30924) is a 2,3-dihydroxybutanedioate (CHEBI:30929) |
| 3-carboxy-2,3-dihydroxypropanoate (CHEBI:48929) is conjugate acid of 2,3-dihydroxybutanedioate (CHEBI:30929) |
| IUPAC Name |
|---|
| 2,3-dihydroxybutanedioate |
| Synonym | Source |
|---|---|
| 2,3-dihydroxysuccinate | ChEBI |
| UniProt Name | Source |
|---|---|
| tartrate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1876435 | Beilstein |