EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O8 |
| Net Charge | 0 |
| Average Mass | 206.106 |
| Monoisotopic Mass | 206.00627 |
| SMILES | O=C(O)C(=O)C(C(=O)O)C(O)C(=O)O |
| InChI | InChI=1S/C6H6O8/c7-2(5(11)12)1(4(9)10)3(8)6(13)14/h1-2,7H,(H,9,10)(H,11,12)(H,13,14) |
| InChIKey | YILAUJBAPQXZGM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-oxalomalic acid (CHEBI:30926) is a tricarboxylic acid (CHEBI:27093) |
| 3-oxalomalic acid (CHEBI:30926) is conjugate acid of 3-oxalomalate(3−) (CHEBI:15593) |
| Incoming Relation(s) |
| 3-oxalomalate(3−) (CHEBI:15593) is conjugate base of 3-oxalomalic acid (CHEBI:30926) |
| IUPAC Name |
|---|
| 1-hydroxy-3-oxopropane-1,2,3-tricarboxylic acid |
| Synonyms | Source |
|---|---|
| 1-hydroxy-3-oxo-1,2,3-propanetricarboxylic acid | ChemIDplus |
| 3-Oxalomalic acid | KEGG COMPOUND |