EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10O7 |
| Net Charge | 0 |
| Average Mass | 206.150 |
| Monoisotopic Mass | 206.04265 |
| SMILES | O=C(O)CC[C@H](C(=O)O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C7H10O7/c8-4(9)2-1-3(6(11)12)5(10)7(13)14/h3,5,10H,1-2H2,(H,8,9)(H,11,12)(H,13,14)/t3-,5+/m0/s1 |
| InChIKey | OEJZZCGRGVFWHK-WVZVXSGGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-homoisocitric acid (CHEBI:30903) is a homoisocitric acid (CHEBI:29094) |
| (−)-homoisocitric acid (CHEBI:30903) is conjugate acid of (−)-homoisocitrate(3−) (CHEBI:15404) |
| Incoming Relation(s) |
| (−)-homoisocitrate(3−) (CHEBI:15404) is conjugate base of (−)-homoisocitric acid (CHEBI:30903) |
| IUPAC Name |
|---|
| (1R,2S)-1-hydroxybutane-1,2,4-tricarboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| C05662 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5812906 | Beilstein |
| Beilstein:7478627 | Beilstein |