EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8O6S2 |
| Net Charge | 0 |
| Average Mass | 288.302 |
| Monoisotopic Mass | 287.97623 |
| SMILES | O=S(=O)(O)c1ccc2ccc(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C10H8O6S2/c11-17(12,13)9-3-1-7-2-4-10(18(14,15)16)6-8(7)5-9/h1-6H,(H,11,12,13)(H,14,15,16) |
| InChIKey | VILFVXYKHXVYAB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naphthalene-2,7-disulfonic acid (CHEBI:30898) has role environmental contaminant (CHEBI:78298) |
| naphthalene-2,7-disulfonic acid (CHEBI:30898) has role xenobiotic (CHEBI:35703) |
| naphthalene-2,7-disulfonic acid (CHEBI:30898) is a naphthalenesulfonic acid (CHEBI:36336) |
| IUPAC Name |
|---|
| naphthalene-2,7-disulfonic acid |
| Synonyms | Source |
|---|---|
| 2,7-naphthalenedisulfonic acid | ChemIDplus |
| naphthalene-2,7-disulphonic acid | ChemIDplus |
| Ebert-Merz α-acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2221087 | Reaxys |
| CAS:92-41-1 | ChemIDplus |