EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5O7 |
| Net Charge | -3 |
| Average Mass | 189.099 |
| Monoisotopic Mass | 189.00517 |
| SMILES | O=C([O-])C[C@@H](C(=O)[O-])[C@H](O)C(=O)[O-] |
| InChI | InChI=1S/C6H8O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13)/p-3/t2-,4+/m1/s1 |
| InChIKey | ODBLHEXUDAPZAU-FONMRSAGSA-K |
| Roles Classification |
|---|
| Biological Roles: | fundamental metabolite Any metabolite produced by all living cells. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-threo-isocitrate(3−) (CHEBI:30896) has role fundamental metabolite (CHEBI:78675) |
| L-threo-isocitrate(3−) (CHEBI:30896) is a isocitrate(3−) (CHEBI:16087) |
| L-threo-isocitrate(3−) (CHEBI:30896) is conjugate base of L-threo-isocitric acid (CHEBI:30889) |
| L-threo-isocitrate(3−) (CHEBI:30896) is enantiomer of D-threo-isocitrate(3−) (CHEBI:15562) |
| Incoming Relation(s) |
| L-threo-isocitric acid (CHEBI:30889) is conjugate acid of L-threo-isocitrate(3−) (CHEBI:30896) |
| D-threo-isocitrate(3−) (CHEBI:15562) is enantiomer of L-threo-isocitrate(3−) (CHEBI:30896) |
| IUPAC Name |
|---|
| (1S,2R)-1-hydroxypropane-1,2,3-tricarboxylate |