EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18N4O4S |
| Net Charge | 0 |
| Average Mass | 350.400 |
| Monoisotopic Mass | 350.10488 |
| SMILES | [H][C@]12[C@@H](C)C(SC3Cn4cnc[n+]4C3)=C(C(=O)[O-])N1C(=O)[C@]2([H])[C@@H](C)O |
| InChI | InChI=1S/C15H18N4O4S/c1-7-11-10(8(2)20)14(21)19(11)12(15(22)23)13(7)24-9-3-17-5-16-6-18(17)4-9/h5-11,20H,3-4H2,1-2H3/t7-,8-,10-,11-/m1/s1 |
| InChIKey | MRMBZHPJVKCOMA-YJFSRANCSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| biapenem (CHEBI:3089) has role antibacterial drug (CHEBI:36047) |
| biapenem (CHEBI:3089) is a carbapenems (CHEBI:46633) |
| biapenem (CHEBI:3089) is a organic sulfide (CHEBI:16385) |
| biapenem (CHEBI:3089) is a pyrazolotriazole (CHEBI:50752) |
| IUPAC Name |
|---|
| (6S)-2-(6,7-dihydro-5H-pyrazolo[1,2-a][1,2,4]triazol-4-ium-6-ylsulfanyl)-6-[(1R)-1-hydroxyethyl]-1β-methyl-2,3-didehydro-1-carbapenam-3-carboxylate |
| INN | Source |
|---|---|
| biapenem | ChemIDplus |
| Synonyms | Source |
|---|---|
| (4R,5S,6S)-3-(6,7-dihydro-5H-pyrazolo[1,2-a][1,2,4]triazol-4-ium-6-ylthio)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate | IUPAC |
| Biapenem | KEGG COMPOUND |
| BIPM | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5835582 | Beilstein |
| Beilstein:7394875 | Beilstein |
| CAS:120410-24-4 | KEGG COMPOUND |
| CAS:120410-24-4 | ChemIDplus |
| Citations |
|---|