EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18N6O3 |
| Net Charge | 0 |
| Average Mass | 306.326 |
| Monoisotopic Mass | 306.14404 |
| SMILES | C/C(=C\CNc1ncnc2c1ncn2CC(N)C(=O)O)CO |
| InChI | InChI=1S/C13H18N6O3/c1-8(5-20)2-3-15-11-10-12(17-6-16-11)19(7-18-10)4-9(14)13(21)22/h2,6-7,9,20H,3-5,14H2,1H3,(H,21,22)(H,15,16,17)/b8-2+ |
| InChIKey | LJJHXRRUVASJDX-KRXBUXKQSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lupinic acid (CHEBI:30885) is a alanine derivative (CHEBI:22278) |
| lupinic acid (CHEBI:30885) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| lupinic acid (CHEBI:30885) is a purine alkaloid (CHEBI:26385) |
| Incoming Relation(s) |
| L-lupinic acid (CHEBI:6572) is a lupinic acid (CHEBI:30885) |
| IUPAC Name |
|---|
| 3-{6-[(2E)-4-hydroxy-3-methylbut-2-en-1-ylamino]-9H-purin-9-yl}-alanine |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1227755 | Beilstein |