EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4N4O4 |
| Net Charge | 0 |
| Average Mass | 196.122 |
| Monoisotopic Mass | 196.02325 |
| SMILES | O=C(O)c1nc2nc(=O)nc(=O)c2n1 |
| InChI | InChI=1S/C6H4N4O4/c11-4-1-2(9-6(14)10-4)8-3(7-1)5(12)13/h(H,12,13)(H3,7,8,9,10,11,14) |
| InChIKey | VRZJGNXBSRQZGM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xanthine-8-carboxylic acid (CHEBI:30881) has functional parent xanthine (CHEBI:15318) |
| xanthine-8-carboxylic acid (CHEBI:30881) is a purinemonocarboxylic acid (CHEBI:38667) |
| xanthine-8-carboxylic acid (CHEBI:30881) is conjugate acid of xanthine-8-carboxylate (CHEBI:16806) |
| Incoming Relation(s) |
| xanthine-8-carboxylate (CHEBI:16806) is conjugate base of xanthine-8-carboxylic acid (CHEBI:30881) |
| IUPAC Name |
|---|
| 2,6-dioxo-2,3,6,7-tetrahydro-1H-purine-8-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| C03314 | KEGG COMPOUND |