EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3088 - bilanafos
| Formula | C11H22N3O6P |
| Net Charge | 0 |
| Average Mass | 323.286 |
| Monoisotopic Mass | 323.12462 |
| SMILES | C[C@H](NC(=O)[C@H](C)NC(=O)[C@@H](N)CCP(C)(=O)O)C(=O)O |
| InChI | InChI=1S/C11H22N3O6P/c1-6(9(15)14-7(2)11(17)18)13-10(16)8(12)4-5-21(3,19)20/h6-8H,4-5,12H2,1-3H3,(H,13,16)(H,14,15)(H,17,18)(H,19,20)/t6-,7-,8-/m0/s1 |
| InChIKey | GINJFDRNADDBIN-FXQIFTODSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces hygroscopicus (ncbitaxon:1912) | - | PubMed (16453790) | |
| Streptomyces viridochromogenes (ncbitaxon:1938) | - | PubMed (24498397) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bilanafos (CHEBI:3088) has role antimicrobial agent (CHEBI:33281) |
| bilanafos (CHEBI:3088) has role bacterial metabolite (CHEBI:76969) |
| bilanafos (CHEBI:3088) is a phosphinic acids (CHEBI:26044) |
| bilanafos (CHEBI:3088) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| N-{(2S)-2-amino-4-[hydroxy(methyl)phosphoryl]butanoyl}-L-alanyl-L-alanine |
| Synonyms | Source |
|---|---|
| 2-Amino-4-(methylphosphino)butyrylalanylalanine | KEGG COMPOUND |
| (2S)-2-amino-4-[hydroxy(methyl)phosphinoyl]butyryl-L-alanyl-L-alanine | Alan Wood's Pesticides |
| (2S)-2-amino-4-(hydroxymethylphosphinyl)butanoyl-L-alanyl-L-alanine | Alan Wood's Pesticides |
| Antibiotic SF 1293 | ChemIDplus |
| Bialaphos | KEGG COMPOUND |
| Bilanafos | KEGG COMPOUND |
| Citations |
|---|