EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H6O5 |
| Net Charge | 0 |
| Average Mass | 194.142 |
| Monoisotopic Mass | 194.02152 |
| SMILES | O=C(O)C(=O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C9H6O5/c10-7(9(13)14)5-2-1-3-6(4-5)8(11)12/h1-4H,(H,11,12)(H,13,14) |
| InChIKey | WVPYGTHKWYSUNM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-oxalobenzoic acid (CHEBI:30876) has functional parent benzoic acid (CHEBI:30746) |
| 3-oxalobenzoic acid (CHEBI:30876) is a oxo dicarboxylic acid (CHEBI:36145) |
| IUPAC Name |
|---|
| 3-oxalobenzoic acid |
| Synonym | Source |
|---|---|
| 3-(carboxycarbonyl)benzoic acid | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1955715 | Beilstein |