EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O2 |
| Net Charge | 0 |
| Average Mass | 442.728 |
| Monoisotopic Mass | 442.38108 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@](C)(CC[C@@]4(CO)CC[C@@H](C(=C)C)[C@@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H50O2/c1-19(2)20-10-15-30(18-31)17-16-28(6)21(25(20)30)8-9-23-27(5)13-12-24(32)26(3,4)22(27)11-14-29(23,28)7/h20-25,31-32H,1,8-18H2,2-7H3/t20-,21+,22-,23+,24-,25+,27-,28+,29+,30+/m0/s1 |
| InChIKey | FVWJYYTZTCVBKE-ROUWMTJPSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| betulin (CHEBI:3086) has parent hydride lupane (CHEBI:36485) |
| betulin (CHEBI:3086) has role analgesic (CHEBI:35480) |
| betulin (CHEBI:3086) has role anti-inflammatory agent (CHEBI:67079) |
| betulin (CHEBI:3086) has role antineoplastic agent (CHEBI:35610) |
| betulin (CHEBI:3086) has role antiviral agent (CHEBI:22587) |
| betulin (CHEBI:3086) has role metabolite (CHEBI:25212) |
| betulin (CHEBI:3086) is a diol (CHEBI:23824) |
| betulin (CHEBI:3086) is a pentacyclic triterpenoid (CHEBI:25872) |
| Incoming Relation(s) |
| betulin di(3-carboxybutanoate) (CHEBI:65486) has functional parent betulin (CHEBI:3086) |
| IUPAC Name |
|---|
| (3β)-lup-20(29)-ene-3,28-diol |
| Synonyms | Source |
|---|---|
| Betuline | ChemIDplus |
| Betulinol | ChemIDplus |
| Betulol | ChemIDplus |
| Trochol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Betulin | Wikipedia |
| C00003740 | KNApSAcK |
| C08618 | KEGG COMPOUND |
| HMDB0036838 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2064515 | Reaxys |
| CAS:473-98-3 | KEGG COMPOUND |
| CAS:473-98-3 | ChemIDplus |
| Citations |
|---|