EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12O5 |
| Net Charge | 0 |
| Average Mass | 176.168 |
| Monoisotopic Mass | 176.06847 |
| SMILES | CCCC(C(=O)O)C(O)C(=O)O |
| InChI | InChI=1S/C7H12O5/c1-2-3-4(6(9)10)5(8)7(11)12/h4-5,8H,2-3H2,1H3,(H,9,10)(H,11,12) |
| InChIKey | LOLHYFQEDPGSHZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-propylmalic acid (CHEBI:30850) has functional parent succinic acid (CHEBI:15741) |
| 3-propylmalic acid (CHEBI:30850) is a 2-hydroxy carboxylic acid (CHEBI:52618) |
| 3-propylmalic acid (CHEBI:30850) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| 3-propylmalic acid (CHEBI:30850) is a dicarboxylic fatty acid (CHEBI:189840) |
| 3-propylmalic acid (CHEBI:30850) is conjugate acid of 3-propylmalate(2−) (CHEBI:15594) |
| Incoming Relation(s) |
| 3-propylmalate(2−) (CHEBI:15594) is conjugate base of 3-propylmalic acid (CHEBI:30850) |
| IUPAC Name |
|---|
| 2-hydroxy-3-propylbutanedioic acid |
| Synonym | Source |
|---|---|
| 3-propylmalic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C02123 | KEGG COMPOUND |