EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H4O4 |
| Net Charge | 0 |
| Average Mass | 104.061 |
| Monoisotopic Mass | 104.01096 |
| SMILES | O=C(O)C(=O)CO |
| InChI | InChI=1S/C3H4O4/c4-1-2(5)3(6)7/h4H,1H2,(H,6,7) |
| InChIKey | HHDDCCUIIUWNGJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxypyruvic acid (CHEBI:30841) has functional parent pyruvic acid (CHEBI:32816) |
| 3-hydroxypyruvic acid (CHEBI:30841) has role Escherichia coli metabolite (CHEBI:76971) |
| 3-hydroxypyruvic acid (CHEBI:30841) has role human metabolite (CHEBI:77746) |
| 3-hydroxypyruvic acid (CHEBI:30841) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 3-hydroxypyruvic acid (CHEBI:30841) is a 3-hydroxy monocarboxylic acid (CHEBI:35969) |
| 3-hydroxypyruvic acid (CHEBI:30841) is a primary α-hydroxy ketone (CHEBI:139590) |
| 3-hydroxypyruvic acid (CHEBI:30841) is conjugate acid of 3-hydroxypyruvate (CHEBI:17180) |
| Incoming Relation(s) |
| 3-hydroxypyruvate (CHEBI:17180) is conjugate base of 3-hydroxypyruvic acid (CHEBI:30841) |
| IUPAC Name |
|---|
| 3-hydroxy-2-oxopropanoic acid |
| Synonyms | Source |
|---|---|
| 3-Hydroxypyruvic acid | KEGG COMPOUND |
| 3-HYDROXYPYRUVIC ACID | PDBeChem |
| Hydroxypyruvic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 3PY | PDBeChem |
| C00007563 | KNApSAcK |
| C00168 | KEGG COMPOUND |
| DB02951 | DrugBank |
| HMDB0001352 | HMDB |
| Hydroxypyruvic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721079 | Reaxys |
| CAS:1113-60-6 | KEGG COMPOUND |
| CAS:1113-60-6 | ChemIDplus |
| Citations |
|---|