EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O2 |
| Net Charge | 0 |
| Average Mass | 282.468 |
| Monoisotopic Mass | 282.25588 |
| SMILES | CCCCCCCCCCC/C=C/CCCCC(=O)O |
| InChI | InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h12-13H,2-11,14-17H2,1H3,(H,19,20)/b13-12+ |
| InChIKey | CNVZJPUDSLNTQU-OUKQBFOZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| petroselaidic acid (CHEBI:30829) is a octadec-6-enoic acid (CHEBI:36022) |
| petroselaidic acid (CHEBI:30829) is conjugate acid of petroselaidate (CHEBI:32377) |
| Incoming Relation(s) |
| petroselaidate (CHEBI:32377) is conjugate base of petroselaidic acid (CHEBI:30829) |
| petroselaidoyl group (CHEBI:32378) is substituent group from petroselaidic acid (CHEBI:30829) |
| IUPAC Name |
|---|
| (6E)-octadec-6-enoic acid |
| Synonyms | Source |
|---|---|
| 6E-octadecenoic acid | LIPID MAPS |
| trans-6-octadecenoic acid | LIPID MAPS |
| trans-octadec-6-enoic acid | ChEBI |
| trans-Δ6-octadecenoic acid | ChEBI |
| octadec-6t-enoic acid | ChEBI |
| Octadec-6t-ensäure | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030067 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1726528 | Reaxys |