EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O3 |
| Net Charge | 0 |
| Average Mass | 298.467 |
| Monoisotopic Mass | 298.25079 |
| SMILES | CCCCCCCCCCCCCCCCC(=O)C(=O)O |
| InChI | InChI=1S/C18H34O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(19)18(20)21/h2-16H2,1H3,(H,20,21) |
| InChIKey | JUCAMRNDACLKGY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ailuropoda melanoleuca (ncbitaxon:9646) | milk (BTO:0000868) | PubMed (26630345) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxooctadecanoic acid (CHEBI:30820) has functional parent octadecanoic acid (CHEBI:28842) |
| 2-oxooctadecanoic acid (CHEBI:30820) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 2-oxooctadecanoic acid (CHEBI:30820) is conjugate acid of 2-oxooctadecanoate (CHEBI:17162) |
| Incoming Relation(s) |
| 2-oxooctadecanoate (CHEBI:17162) is conjugate base of 2-oxooctadecanoic acid (CHEBI:30820) |
| IUPAC Name |
|---|
| 2-oxooctadecanoic acid |
| Synonyms | Source |
|---|---|
| 2-Oxooctadecanoic acid | KEGG COMPOUND |
| 2-oxo-octadecanoic acid | ChEBI |
| 2-oxostearic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00869 | KEGG COMPOUND |
| LMFA01060119 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1789750 | Reaxys |
| Citations |
|---|