EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O3 |
| Net Charge | 0 |
| Average Mass | 454.695 |
| Monoisotopic Mass | 454.34470 |
| SMILES | [H][C@]12CC[C@]3([H])C4=CC(C)(C)CC[C@]4(C(=O)O)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)C(=O)CC[C@]21C |
| InChI | InChI=1S/C30H46O3/c1-25(2)14-16-30(24(32)33)17-15-28(6)19(20(30)18-25)8-9-22-27(5)12-11-23(31)26(3,4)21(27)10-13-29(22,28)7/h18-19,21-22H,8-17H2,1-7H3,(H,32,33)/t19-,21+,22-,27+,28-,29-,30+/m1/s1 |
| InChIKey | UMYJVVZWBKIXQQ-QALSDZMNSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Boronia inornata (IPNI:771630-1) | |||
| aerial part (BTO:0001658) | DOI (10.1016/0031-9422(94)00567-D) | ||
| root (BTO:0001188) | DOI (10.1016/0031-9422(94)00567-D) | ||
| Brucea javanica (ncbitaxon:210348) | - | PubMed (10086989) | |
| Evodia meliafolia (ncbitaxon:354493) | stem (BTO:0001300) | Article (INDIAN J PHARM SCI, 1997, 59, 251) | Previous component: stem bark; |
| Phoradendron reichenbachianum (ncbitaxon:136774) | aerial part (BTO:0001658) | PubMed (11488459) | |
| Myrceugenia euosma (IPNI:165419-2) | - | PubMed (11678650) |
| Roles Classification |
|---|
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HSV-1 agent An anti-HSV agent agent that destroys or inhibits the replication of herpes simplex virus-1. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| moronic acid (CHEBI:30815) has parent hydride oleanane (CHEBI:36481) |
| moronic acid (CHEBI:30815) has role anti-HIV agent (CHEBI:64946) |
| moronic acid (CHEBI:30815) has role anti-HSV-1 agent (CHEBI:64953) |
| moronic acid (CHEBI:30815) has role metabolite (CHEBI:25212) |
| moronic acid (CHEBI:30815) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| 3-oxoolean-18-en-28-oic acid |
| Synonym | Source |
|---|---|
| (4aS,6aR,6bR,8aR,12aR,12bR,14aS)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14,14a-icosahydropicene-4a-carboxylic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| Moronic_acid | Wikipedia |
| LMPR0106150002 | LIPID MAPS |
| JP9328426 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2913336 | Reaxys |
| CAS:6713-27-5 | ChemIDplus |
| Citations |
|---|