EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O3 |
| Net Charge | 0 |
| Average Mass | 454.695 |
| Monoisotopic Mass | 454.34470 |
| SMILES | [H][C@]12CC[C@]3([H])C4=CC(C)(C)CC[C@]4(C(=O)O)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)C(=O)CC[C@]21C |
| InChI | InChI=1S/C30H46O3/c1-25(2)14-16-30(24(32)33)17-15-28(6)19(20(30)18-25)8-9-22-27(5)12-11-23(31)26(3,4)21(27)10-13-29(22,28)7/h18-19,21-22H,8-17H2,1-7H3,(H,32,33)/t19-,21+,22-,27+,28-,29-,30+/m1/s1 |
| InChIKey | UMYJVVZWBKIXQQ-QALSDZMNSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Boronia inornata (IPNI:771630-1) | |||
| aerial part (BTO:0001658) | DOI (10.1016/0031-9422(94)00567-D) | ||
| root (BTO:0001188) | DOI (10.1016/0031-9422(94)00567-D) | ||
| Brucea javanica (ncbitaxon:210348) | - | PubMed (10086989) | |
| Evodia meliafolia (ncbitaxon:354493) | stem (BTO:0001300) | Article (INDIAN J PHARM SCI, 1997, 59, 251) | Previous component: stem bark; |
| Myrceugenia euosma (IPNI:165419-2) | - | PubMed (11678650) | |
| Phoradendron reichenbachianum (ncbitaxon:136774) | aerial part (BTO:0001658) | PubMed (11488459) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. anti-HSV-1 agent An anti-HSV agent agent that destroys or inhibits the replication of herpes simplex virus-1. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| moronic acid (CHEBI:30815) has parent hydride oleanane (CHEBI:36481) |
| moronic acid (CHEBI:30815) has role anti-HIV agent (CHEBI:64946) |
| moronic acid (CHEBI:30815) has role anti-HSV-1 agent (CHEBI:64953) |
| moronic acid (CHEBI:30815) has role metabolite (CHEBI:25212) |
| moronic acid (CHEBI:30815) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| 3-oxoolean-18-en-28-oic acid |
| Synonym | Source |
|---|---|
| (4aS,6aR,6bR,8aR,12aR,12bR,14aS)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14,14a-icosahydropicene-4a-carboxylic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| JP9328426 | Patent |
| LMPR0106150002 | LIPID MAPS |
| Moronic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2913336 | Reaxys |
| CAS:6713-27-5 | ChemIDplus |
| Citations |
|---|