EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H12O6 |
| Net Charge | 0 |
| Average Mass | 312.277 |
| Monoisotopic Mass | 312.06339 |
| SMILES | COc1c2c(cc3occ(-c4ccccc4O)c(=O)c13)OCO2 |
| InChI | InChI=1S/C17H12O6/c1-20-17-14-12(6-13-16(17)23-8-22-13)21-7-10(15(14)19)9-4-2-3-5-11(9)18/h2-7,18H,8H2,1H3 |
| InChIKey | NDVRQFZUJRMKKP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Iris tenuifolia (ncbitaxon:198827) | whole plant (BTO:0001461) | PubMed (18472117) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| betavulgarin (CHEBI:3081) has functional parent isoflavone (CHEBI:18220) |
| betavulgarin (CHEBI:3081) has role plant metabolite (CHEBI:76924) |
| betavulgarin (CHEBI:3081) is a hydroxyisoflavone (CHEBI:38755) |
| betavulgarin (CHEBI:3081) is a methoxyisoflavone (CHEBI:38756) |
| IUPAC Name |
|---|
| 7-(2-hydroxyphenyl)-9-methoxy-2H,8H-[1,3]dioxolo[4,5-g][1]benzopyran-8-one |
| Synonym | Source |
|---|---|
| 2'-Hydroxy-5-methoxy-6,7-methylenedioxyisoflavone | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| C10201 | KEGG COMPOUND |
| C00002509 | KNApSAcK |
| LMPK12050361 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1266639 | Reaxys |
| CAS:51068-94-1 | KEGG COMPOUND |
| Citations |
|---|