EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H5O4 |
| Net Charge | -1 |
| Average Mass | 165.124 |
| Monoisotopic Mass | 165.01933 |
| SMILES | O=C([O-])c1ccccc1C(=O)O |
| InChI | InChI=1S/C8H6O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H,9,10)(H,11,12)/p-1 |
| InChIKey | XNGIFLGASWRNHJ-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phthalate(1−) (CHEBI:30800) has role human xenobiotic metabolite (CHEBI:76967) |
| phthalate(1−) (CHEBI:30800) is a dicarboxylic acid monoanion (CHEBI:35695) |
| phthalate(1−) (CHEBI:30800) is a phthalate (CHEBI:26092) |
| phthalate(1−) (CHEBI:30800) is conjugate acid of phthalate(2−) (CHEBI:17563) |
| phthalate(1−) (CHEBI:30800) is conjugate base of phthalic acid (CHEBI:29069) |
| Incoming Relation(s) |
| phthalic acid (CHEBI:29069) is conjugate acid of phthalate(1−) (CHEBI:30800) |
| phthalate(2−) (CHEBI:17563) is conjugate base of phthalate(1−) (CHEBI:30800) |
| IUPAC Name |
|---|
| 2-carboxybenzoate |
| Synonym | Source |
|---|---|
| hydrogen phthalate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1876115 | Reaxys |
| Gmelin:328025 | Gmelin |