EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6O5S |
| Net Charge | 0 |
| Average Mass | 202.187 |
| Monoisotopic Mass | 201.99359 |
| SMILES | O=C(O)c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C7H6O5S/c8-7(9)5-1-3-6(4-2-5)13(10,11)12/h1-4H,(H,8,9)(H,10,11,12) |
| InChIKey | HWAQOZGATRIYQG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-sulfobenzoic acid (CHEBI:30789) has functional parent benzoic acid (CHEBI:30746) |
| 4-sulfobenzoic acid (CHEBI:30789) is a sulfobenzoic acid (CHEBI:26825) |
| 4-sulfobenzoic acid (CHEBI:30789) is conjugate acid of 4-sulfobenzoate(1−) (CHEBI:16309) |
| 4-sulfobenzoic acid (CHEBI:30789) is conjugate acid of 4-sulfonatobenzoate(2−) (CHEBI:20476) |
| Incoming Relation(s) |
| 4-sulfobenzoate(1−) (CHEBI:16309) is conjugate base of 4-sulfobenzoic acid (CHEBI:30789) |
| 4-sulfonatobenzoate(2−) (CHEBI:20476) is conjugate base of 4-sulfobenzoic acid (CHEBI:30789) |
| IUPAC Name |
|---|
| 4-sulfobenzoic acid |
| Synonyms | Source |
|---|---|
| 4-Sulfobenzoic acid | KEGG COMPOUND |
| 4-sulphobenzoic acid | ChEBI |
| para-sulfobenzoic acid | ChemIDplus |
| p-sulfobenzoic acid | ChemIDplus |
| HO3S‒C6H4‒COOH | ChEBI |
| Citations |
|---|