EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O3 |
| Net Charge | 0 |
| Average Mass | 166.176 |
| Monoisotopic Mass | 166.06299 |
| SMILES | O=C(O)C(CO)c1ccccc1 |
| InChI | InChI=1S/C9H10O3/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12) |
| InChIKey | JACRWUWPXAESPB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tropic acid (CHEBI:30765) has functional parent hydratropic acid (CHEBI:48526) |
| tropic acid (CHEBI:30765) has functional parent propionic acid (CHEBI:30768) |
| tropic acid (CHEBI:30765) has role human xenobiotic metabolite (CHEBI:76967) |
| tropic acid (CHEBI:30765) is a 3-hydroxy monocarboxylic acid (CHEBI:35969) |
| tropic acid (CHEBI:30765) is conjugate acid of tropate (CHEBI:17000) |
| Incoming Relation(s) |
| tropan-3α-yl 3-hydroxy-2-phenylpropanoate (CHEBI:78734) has functional parent tropic acid (CHEBI:30765) |
| (R)-tropic acid (CHEBI:30767) is a tropic acid (CHEBI:30765) |
| (S)-tropic acid (CHEBI:30766) is a tropic acid (CHEBI:30765) |
| tropate (CHEBI:17000) is conjugate base of tropic acid (CHEBI:30765) |
| IUPAC Name |
|---|
| 3-hydroxy-2-phenylpropanoic acid |
| Synonyms | Source |
|---|---|
| Tropic acid | KEGG COMPOUND |
| alpha-(Hydroxymethyl)phenylacetic acid | KEGG COMPOUND |
| α-phenyl-β-hydroxypropionic acid | NIST Chemistry WebBook |
| α-(hydroxymethyl)benzeneacetic acid | NIST Chemistry WebBook |
| 2-phenylhydracrylic acid | ChemIDplus |
| β-hydroxyhydratropic acid | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C01456 | KEGG COMPOUND |
| Tropic_acid | Wikipedia |
| C00035885 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2209199 | Reaxys |
| CAS:552-63-6 | ChemIDplus |
| CAS:552-63-6 | KEGG COMPOUND |
| Citations |
|---|