EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H24N2O10 |
| Net Charge | 0 |
| Average Mass | 380.350 |
| Monoisotopic Mass | 380.14309 |
| SMILES | O=C(O)CN(CCOCCOCCN(CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C14H24N2O10/c17-11(18)7-15(8-12(19)20)1-3-25-5-6-26-4-2-16(9-13(21)22)10-14(23)24/h1-10H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | DEFVIWRASFVYLL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethylene glycol bis(2-aminoethyl)tetraacetic acid (CHEBI:30740) has role chelator (CHEBI:38161) |
| ethylene glycol bis(2-aminoethyl)tetraacetic acid (CHEBI:30740) is a diether (CHEBI:46786) |
| ethylene glycol bis(2-aminoethyl)tetraacetic acid (CHEBI:30740) is a tertiary amino compound (CHEBI:50996) |
| ethylene glycol bis(2-aminoethyl)tetraacetic acid (CHEBI:30740) is a tetracarboxylic acid (CHEBI:35742) |
| Incoming Relation(s) |
| EGTA acetoxymethyl ester (CHEBI:232417) has functional parent ethylene glycol bis(2-aminoethyl)tetraacetic acid (CHEBI:30740) |
| IUPAC Name |
|---|
| 2,2',2'',2'''-[ethane-1,2-diylbis(oxyethane-2,1-diylnitrilo)]tetraacetic acid |
| Synonyms | Source |
|---|---|
| 3,12-bis(carboxymethyl)-6,9-dioxa-3,12-diazatetradecanedioic acid | ChemIDplus |
| EGTA | ChemIDplus |
| Egtazic acid | ChemIDplus |
| [ethylenebis(oxyethylenenitrilo)]tetraacetic acid | ChEBI |
| ethylene glycol bis(β-aminoethyl ether)-N,N,N',N'-tetraacetic acid | ChEBI |
| ethylene glycol-O,O'-bis(2-aminoethyl)-N,N,N',N'-tetraacetic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| EGTA_(chemical) | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1717370 | Reaxys |
| Gmelin:234970 | Gmelin |
| CAS:67-42-5 | ChemIDplus |
| Citations |
|---|