EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3070 - bestatin
| Formula | C16H24N2O4 |
| Net Charge | 0 |
| Average Mass | 308.378 |
| Monoisotopic Mass | 308.17361 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](O)[C@H](N)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H24N2O4/c1-10(2)8-13(16(21)22)18-15(20)14(19)12(17)9-11-6-4-3-5-7-11/h3-7,10,12-14,19H,8-9,17H2,1-2H3,(H,18,20)(H,21,22)/t12-,13+,14+/m1/s1 |
| InChIKey | VGGGPCQERPFHOB-RDBSUJKOSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces olivoreticuli (ncbitaxon:68246) | - | PubMed (931798) | Strain: MD976-C7 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | protease inhibitor A compound which inhibits or antagonizes the biosynthesis or actions of proteases (endopeptidases). immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. EC 3.4.11.* (aminopeptidase) inhibitor An EC 3.4.* (hydrolases acting on peptide bond) inhibitor that interferes wtih the action of any aminopeptidase (EC 3.4.11.*). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bestatin (CHEBI:3070) has role antineoplastic agent (CHEBI:35610) |
| bestatin (CHEBI:3070) has role bacterial metabolite (CHEBI:76969) |
| bestatin (CHEBI:3070) has role EC 3.4.11.* (aminopeptidase) inhibitor (CHEBI:76787) |
| bestatin (CHEBI:3070) has role immunomodulator (CHEBI:50846) |
| bestatin (CHEBI:3070) has role protease inhibitor (CHEBI:37670) |
| bestatin (CHEBI:3070) is a L-leucine derivative (CHEBI:25018) |
| bestatin (CHEBI:3070) is a dipeptide (CHEBI:46761) |
| bestatin (CHEBI:3070) is a secondary carboxamide (CHEBI:140325) |
| bestatin (CHEBI:3070) is tautomer of bestatin zwitterion (CHEBI:746940) |
| Incoming Relation(s) |
| bestatin zwitterion (CHEBI:746940) is tautomer of bestatin (CHEBI:3070) |
| IUPAC Name |
|---|
| N-[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]-L-leucine |
| INNs | Source |
|---|---|
| ubenimex | WHO MedNet |
| ubenimex | WHO MedNet |
| ubénimex | WHO MedNet |
| ubenimexum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (2S)-2-[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanamido]-4-methylpentanoic acid | ChEBI |
| [(2S,3R)-3-amino-2-hydroxy-4-phenylbutyryl]-L-leucine | ChEBI |
| (−)-bestatin | CAS |
| N-[(2S,3R)-3-amino-2-hydroxy-1-oxo-4-phenylbutyl]-L-leucine | CAS |
| NK 421 | CAS |
| NK-421 | ChEBI |
| Citations |
|---|