EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3070 - bestatin
| Formula | C16H24N2O4 |
| Net Charge | 0 |
| Average Mass | 308.378 |
| Monoisotopic Mass | 308.17361 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](O)[C@H](N)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H24N2O4/c1-10(2)8-13(16(21)22)18-15(20)14(19)12(17)9-11-6-4-3-5-7-11/h3-7,10,12-14,19H,8-9,17H2,1-2H3,(H,18,20)(H,21,22)/t12-,13+,14+/m1/s1 |
| InChIKey | VGGGPCQERPFHOB-RDBSUJKOSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces olivoreticuli (ncbitaxon:68246) | - | PubMed (931798) | Strain: MD976-C7 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | protease inhibitor A compound which inhibits or antagonizes the biosynthesis or actions of proteases (endopeptidases). immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. EC 3.4.11.* (aminopeptidase) inhibitor An EC 3.4.* (hydrolases acting on peptide bond) inhibitor that interferes wtih the action of any aminopeptidase (EC 3.4.11.*). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bestatin (CHEBI:3070) has role antihypertensive agent (CHEBI:35674) |
| bestatin (CHEBI:3070) has role antineoplastic agent (CHEBI:35610) |
| bestatin (CHEBI:3070) has role bacterial metabolite (CHEBI:76969) |
| bestatin (CHEBI:3070) has role EC 3.4.11.* (aminopeptidase) inhibitor (CHEBI:76787) |
| bestatin (CHEBI:3070) has role immunomodulator (CHEBI:50846) |
| bestatin (CHEBI:3070) has role protease inhibitor (CHEBI:37670) |
| bestatin (CHEBI:3070) is a L-leucine derivative (CHEBI:25018) |
| bestatin (CHEBI:3070) is a dipeptide (CHEBI:46761) |
| bestatin (CHEBI:3070) is a secondary carboxamide (CHEBI:140325) |
| bestatin (CHEBI:3070) is tautomer of bestatin zwitterion (CHEBI:746940) |
| Incoming Relation(s) |
| bestatin zwitterion (CHEBI:746940) is tautomer of bestatin (CHEBI:3070) |
| IUPAC Name |
|---|
| N-[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]-L-leucine |
| INNs | Source |
|---|---|
| ubenimex | WHO MedNet |
| ubenimex | WHO MedNet |
| ubénimex | WHO MedNet |
| ubenimexum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (2S)-2-[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanamido]-4-methylpentanoic acid | ChEBI |
| [(2S,3R)-3-amino-2-hydroxy-4-phenylbutyryl]-L-leucine | ChEBI |
| (−)-bestatin | CAS |
| Bestatin | ChEMBL |
| N-[(2S,3R)-3-amino-2-hydroxy-1-oxo-4-phenylbutyl]-L-leucine | CAS |
| NK 421 | CAS |
| Citations |
|---|