EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:30672 - ferrocene
| Formula | C10H10Fe |
| Net Charge | 0 |
| Average Mass | 186.035 |
| Monoisotopic Mass | 186.01319 |
| SMILES | [CH]12[CH]3[CH]4[CH]5[CH]1[Fe]23451678[CH]2[CH]1[CH]6[CH]7[CH]28 |
| InChI | InChI=1S/2C5H5.Fe/c2*1-2-4-5-3-1;/h2*1-5H; |
| InChIKey | DFRHTHSZMBROSH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | fuel additive Any additive that enhances the efficiency of fuel. |
| Application: | fuel additive Any additive that enhances the efficiency of fuel. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ferrocene (CHEBI:30672) has role fuel additive (CHEBI:62803) |
| ferrocene (CHEBI:30672) is a bis(η5-cyclopentadienyl)metal(II) (CHEBI:51002) |
| ferrocene (CHEBI:30672) is a ferrocenes (CHEBI:51005) |
| Incoming Relation(s) |
| (dimethylcarbamoyl)ferrocene (CHEBI:30675) has parent hydride ferrocene (CHEBI:30672) |
| N-(2-ferrocenylethyl)maleimide (CHEBI:30735) has parent hydride ferrocene (CHEBI:30672) |
| 1,1'-bis(diphenylphosphanyl)ferrocene (CHEBI:30743) has parent hydride ferrocene (CHEBI:30672) |
| 1,1'-dimethylferrocene (CHEBI:30739) has parent hydride ferrocene (CHEBI:30672) |
| 1'-(dimethylcarbamoyl)ferrocene-1-carboxylic acid (CHEBI:48793) has parent hydride ferrocene (CHEBI:30672) |
| ethylferrocene (CHEBI:30738) has parent hydride ferrocene (CHEBI:30672) |
| ferrocenecarboxylic acid (CHEBI:30674) has parent hydride ferrocene (CHEBI:30672) |
| IUPAC Names |
|---|
| bis(η5-cyclopentadienyl)iron |
| bis(η5-cyclopentadienyl)iron(II) |
| ferrocene |
| Synonyms | Source |
|---|---|
| bis(cyclopentadienyl)iron | NIST Chemistry WebBook |
| biscyclopentadienyliron | ChemIDplus |
| bis(η5-2,4-cyclopentadien-1-yl)iron | NIST Chemistry WebBook |
| di-2,4-cyclopentadien-1-yliron | ChemIDplus |
| Dicyclopentadienyleisen | ChEBI |
| dicyclopentadienyl iron | ChemIDplus |
| Citations |
|---|