EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11P |
| Net Charge | 0 |
| Average Mass | 138.150 |
| Monoisotopic Mass | 138.05984 |
| SMILES | CP(C)c1ccccc1 |
| InChI | InChI=1S/C8H11P/c1-9(2)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| InChIKey | HASCQPSFPAKVEK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | catalyst A substance that increases the rate of a reaction without modifying the overall standard Gibbs energy change in the reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimethyl(phenyl)phosphine (CHEBI:30671) is a tertiary phosphine (CHEBI:35886) |
| IUPAC Name |
|---|
| dimethyl(phenyl)phosphane |
| Synonyms | Source |
|---|---|
| dimethylphenylphosphine | NIST Chemistry WebBook |
| Me2PPh | IUPAC |
| [PMe2Ph] | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Gmelin:3484 | Gmelin |
| Beilstein:742064 | Beilstein |
| CAS:672-66-2 | NIST Chemistry WebBook |