EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H24P2 |
| Net Charge | 0 |
| Average Mass | 398.426 |
| Monoisotopic Mass | 398.13532 |
| SMILES | c1ccc(P(CCP(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H24P2/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20H,21-22H2 |
| InChIKey | QFMZQPDHXULLKC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | catalyst A substance that increases the rate of a reaction without modifying the overall standard Gibbs energy change in the reaction. |
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2-bis(diphenylphosphino)ethane (CHEBI:30669) has role allergen (CHEBI:50904) |
| 1,2-bis(diphenylphosphino)ethane (CHEBI:30669) is a diphosphanes (CHEBI:51650) |
| 1,2-bis(diphenylphosphino)ethane (CHEBI:30669) is a tertiary phosphine (CHEBI:35886) |
| IUPAC Name |
|---|
| ethane-1,2-diylbis(diphenylphosphane) |
| Synonyms | Source |
|---|---|
| 1,2-bis(diphenylphosphino)-ethane | NIST Chemistry WebBook |
| 1,2-bis(diphenylphosphino)ethane | IUPAC |
| bis(diphenylphosphine)ethane | ChemIDplus |
| Diphos | NIST Chemistry WebBook |
| dppe | IUPAC |