EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15NO4 |
| Net Charge | 0 |
| Average Mass | 273.288 |
| Monoisotopic Mass | 273.10011 |
| SMILES | NC(Cc1ccc(Oc2ccc(O)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C15H15NO4/c16-14(15(18)19)9-10-1-5-12(6-2-10)20-13-7-3-11(17)4-8-13/h1-8,14,17H,9,16H2,(H,18,19) |
| InChIKey | KKCIOUWDFWQUBT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thyronine (CHEBI:30661) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| thyronine (CHEBI:30661) is a phenols (CHEBI:33853) |
| thyronine (CHEBI:30661) is a tyrosine derivative (CHEBI:62761) |
| Incoming Relation(s) |
| iodothyronine (CHEBI:24864) has functional parent thyronine (CHEBI:30661) |
| L-thyronine (CHEBI:30662) is a thyronine (CHEBI:30661) |
| IUPAC Name |
|---|
| thyronine |
| Synonyms | Source |
|---|---|
| O-(4-hydroxyphenyl)-DL-tyrosine | ChemIDplus |
| 2-amino-3-[4-(4-hydroxyphenoxy)phenyl]propanoic acid | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Gmelin:419747 | Gmelin |
| Reaxys:2947040 | Reaxys |
| CAS:1034-10-2 | ChemIDplus |
| Citations |
|---|