EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7NO2 |
| Net Charge | 0 |
| Average Mass | 101.105 |
| Monoisotopic Mass | 101.04768 |
| SMILES | N[C@@H]1CCOC1=O |
| InChI | InChI=1S/C4H7NO2/c5-3-1-2-7-4(3)6/h3H,1-2,5H2/t3-/m1/s1 |
| InChIKey | QJPWUUJVYOJNMH-GSVOUGTGSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-homoserine lactone (CHEBI:30657) is a homoserine lactone (CHEBI:17289) |
| D-homoserine lactone (CHEBI:30657) is enantiomer of L-homoserine lactone (CHEBI:30655) |
| Incoming Relation(s) |
| L-homoserine lactone (CHEBI:30655) is enantiomer of D-homoserine lactone (CHEBI:30657) |
| IUPAC Names |
|---|
| D-homoserine lactone |
| (3S)-3-amino-4,5-dihydrofuran-2(3H)-one |
| Registry Numbers | Sources |
|---|---|
| Beilstein:80585 | Beilstein |