EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | As4O6 |
| Net Charge | 0 |
| Average Mass | 395.682 |
| Monoisotopic Mass | 395.65587 |
| SMILES | O1[As]2O[As]3O[As]1O[As](O2)O3 |
| InChI | InChI=1S/As4O6/c5-1-6-3-8-2(5)9-4(7-1)10-3 |
| InChIKey | KTTMEOWBIWLMSE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diarsenic trioxide (CHEBI:30621) has role antineoplastic agent (CHEBI:35610) |
| diarsenic trioxide (CHEBI:30621) has role insecticide (CHEBI:24852) |
| diarsenic trioxide (CHEBI:30621) is a arsenic oxide (CHEBI:50527) |
| IUPAC Name |
|---|
| tricyclo[3.3.1.13,7]tetraarsoxane |
| Synonyms | Source |
|---|---|
| arsenic(III) oxide | IUPAC |
| diarsenic trioxide | IUPAC |
| Arsenic trioxide | ChemIDplus |
| Diarsenic oxide | NIST Chemistry WebBook |
| As2O3 | IUPAC |
| Acide arsenieux | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D02106 | KEGG DRUG |
| DB01169 | DrugBank |
| Arsenic_trioxide | Wikipedia |
| Citations |
|---|