EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO3 |
| Net Charge | 0 |
| Average Mass | 183.207 |
| Monoisotopic Mass | 183.08954 |
| SMILES | CNC[C@@H](O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H13NO3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9-13H,5H2,1H3/t9-/m1/s1 |
| InChIKey | UCTWMZQNUQWSLP-SECBINFHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-adrenaline (CHEBI:40751) is a 4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol (CHEBI:194548) |
| (S)-adrenaline (CHEBI:40751) is enantiomer of (R)-adrenaline (CHEBI:28918) |
| Incoming Relation(s) |
| adrenaline (CHEBI:33568) has part (S)-adrenaline (CHEBI:40751) |
| (R)-adrenaline (CHEBI:28918) is enantiomer of (S)-adrenaline (CHEBI:40751) |
| IUPAC Name |
|---|
| 4-[(1S)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol |
| Synonyms | Source |
|---|---|
| (+)-3,4-dihydroxy-α-((methylamino)methyl)benzyl alcohol | ChemIDplus |
| (+)-adrenaline | IUPHAR |
| d-adrenaline | ChemIDplus |
| d-epinephrine | ChemIDplus |
| (S)-4-(1-hydroxy-2-(methylamino)ethyl)pyrocatechol | ChemIDplus |
| (S)-(+)-adrenaline | ChEBI |