EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO3 |
| Net Charge | 0 |
| Average Mass | 183.207 |
| Monoisotopic Mass | 183.08954 |
| SMILES | CNC[C@H](O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H13NO3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9-13H,5H2,1H3/t9-/m0/s1 |
| InChIKey | UCTWMZQNUQWSLP-VIFPVBQESA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. adrenergic agonist An agent that selectively binds to and activates adrenergic receptors. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. |
| Applications: | sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. adrenergic agonist An agent that selectively binds to and activates adrenergic receptors. vasodilator agent A drug used to cause dilation of the blood vessels. mydriatic agent Agent that dilates the pupil. Used in eye diseases and to facilitate eye examination. It may be either a sympathomimetic or parasympatholytic. The latter cause cycloplegia or paralysis of accommodation at high doses and may precipitate glaucoma. vasoconstrictor agent Drug used to cause constriction of the blood vessels. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-adrenaline (CHEBI:28918) has role adrenergic agonist (CHEBI:37886) |
| (R)-adrenaline (CHEBI:28918) has role bronchodilator agent (CHEBI:35523) |
| (R)-adrenaline (CHEBI:28918) has role hormone (CHEBI:24621) |
| (R)-adrenaline (CHEBI:28918) has role mouse metabolite (CHEBI:75771) |
| (R)-adrenaline (CHEBI:28918) has role mydriatic agent (CHEBI:50513) |
| (R)-adrenaline (CHEBI:28918) has role sympathomimetic agent (CHEBI:35524) |
| (R)-adrenaline (CHEBI:28918) has role vasoconstrictor agent (CHEBI:50514) |
| (R)-adrenaline (CHEBI:28918) has role vasodilator agent (CHEBI:35620) |
| (R)-adrenaline (CHEBI:28918) has role α-adrenergic agonist (CHEBI:35569) |
| (R)-adrenaline (CHEBI:28918) has role β-adrenergic agonist (CHEBI:35522) |
| (R)-adrenaline (CHEBI:28918) is a 4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol (CHEBI:194548) |
| (R)-adrenaline (CHEBI:28918) is conjugate base of (R)-adrenaline(1+) (CHEBI:71406) |
| (R)-adrenaline (CHEBI:28918) is enantiomer of (S)-adrenaline (CHEBI:40751) |
| Incoming Relation(s) |
| (R)-adrenaline hydrochloride (CHEBI:6213) has part (R)-adrenaline (CHEBI:28918) |
| adrenaline (CHEBI:33568) has part (R)-adrenaline (CHEBI:28918) |
| (R)-adrenaline(1+) (CHEBI:71406) is conjugate acid of (R)-adrenaline (CHEBI:28918) |
| (S)-adrenaline (CHEBI:40751) is enantiomer of (R)-adrenaline (CHEBI:28918) |
| IUPAC Name |
|---|
| 4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol |
| INNs | Source |
|---|---|
| epinefrina | ChemIDplus |
| epinephrine | ChemIDplus |
| épinéphrine | ChEBI |
| epinephrinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (−)-3,4-dihydroxy-α-((methylamino)methyl)benzyl alcohol | NIST Chemistry WebBook |
| 4-[(1R)-1-Hydroxy-2-(methylamino)ethyl]-1,2-benzenediol | KEGG COMPOUND |
| 4-[(1R)-1-Hydroxy-2-(methylamino)ethyl]-1,2-benzenediol | KEGG COMPOUND |
| Adrenalin | NIST Chemistry WebBook |
| (−)-adrenaline | IUPHAR |
| adrenaline | NIST Chemistry WebBook |
| Brand Names | Source |
|---|---|
| Adrenalin | KEGG DRUG |
| Epipen | DrugBank |
| Epipen | KEGG DRUG |
| Epipen JR | DrugBank |
| Primatene | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 1028 | DrugCentral |
| C00029643 | KNApSAcK |
| C00788 | KEGG COMPOUND |
| D00095 | KEGG DRUG |
| DB00668 | DrugBank |
| Epinephrine | Wikipedia |
| HMDB0000068 | HMDB |
| L-EPINEPHRINE | MetaCyc |
| Citations |
|---|