EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H14O3 |
| Net Charge | 0 |
| Average Mass | 302.329 |
| Monoisotopic Mass | 302.09429 |
| SMILES | OC1c2cc3ccc4cccc5ccc(c2C2OC2C1O)c3c45 |
| InChI | InChI=1S/C20H14O3/c21-17-13-8-11-5-4-9-2-1-3-10-6-7-12(15(11)14(9)10)16(13)19-20(23-19)18(17)22/h1-8,17-22H |
| InChIKey | DQEPMTIXHXSFOR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis cerana (ncbitaxon:7461) | - | MetaboLights (MTBLS379) |
| Roles Classification |
|---|
| Biological Role: | intercalator A role played by a chemical agent which exhibits the capability of occupying space between DNA base pairs due to particular properties in size, shape and charge. Intercalation of chemical compounds in DNA helix can result in replication errors (shift, mutation) or DNA damages. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzo[a]pyrene diol epoxide I (CHEBI:30614) has parent hydride benzo[a]pyrene (CHEBI:29865) |
| benzo[a]pyrene diol epoxide I (CHEBI:30614) has role intercalator (CHEBI:24853) |
| benzo[a]pyrene diol epoxide I (CHEBI:30614) is a epoxide (CHEBI:32955) |
| IUPAC Names |
|---|
| 7,8,8a,9a-tetrahydrobenzo[1,12]tetrapheno[10,11-b]oxirene-7,8-diol |
| 7,8,8a,9a-tetrahydrobenzo[10,11]chryseno[3,4-b]oxirene-7,8-diol |
| Synonyms | Source |
|---|---|
| benzo(a)pyrene diolepoxide I | ChemIDplus |
| BPDE | ChemIDplus |
| Benzo(a)pyrene diol epoxide | ChemIDplus |
| BP 7,8-Diol-9,10-epoxide 2 | ChemIDplus |
| 7,8-Dihydro-7,8-dihydroxybenzo[a]pyrene 9,10-oxide | KEGG COMPOUND |
| benzo[a]pyrene-7,8-dihydrodiol-9,10-oxide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C14853 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1353131 | Beilstein |
| CAS:58917-67-2 | ChemIDplus |
| CAS:55097-80-8 | KEGG COMPOUND |