EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:30612 - D-glucarate(2−)
| Formula | C6H8O8 |
| Net Charge | -2 |
| Average Mass | 208.122 |
| Monoisotopic Mass | 208.02301 |
| SMILES | O=C([O-])[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)[O-] |
| InChI | InChI=1S/C6H10O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-4,7-10H,(H,11,12)(H,13,14)/p-2/t1-,2-,3-,4+/m0/s1 |
| InChIKey | DSLZVSRJTYRBFB-LLEIAEIESA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-glucarate(2−) (CHEBI:30612) has role human metabolite (CHEBI:77746) |
| D-glucarate(2−) (CHEBI:30612) is a glucarate(2−) (CHEBI:30613) |
| D-glucarate(2−) (CHEBI:30612) is conjugate base of D-glucarate(1−) (CHEBI:33801) |
| Incoming Relation(s) |
| 5-dehydro-4-deoxy-D-glucarate(2−) (CHEBI:42819) has functional parent D-glucarate(2−) (CHEBI:30612) |
| D-glucarate(1−) (CHEBI:33801) is conjugate acid of D-glucarate(2−) (CHEBI:30612) |
| IUPAC Names |
|---|
| (2R,3S,4S,5S)-2,3,4,5-tetrahydroxyhexanedioate |
| D-glucarate |
| Synonym | Source |
|---|---|
| D-GLUCARATE | PDBeChem |
| UniProt Name | Source |
|---|---|
| D-glucarate | UniProt |